C19H10N2O3 — CID 169331994
4-[4-(5-formylfuran-2-yl)phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 169331994) has the molecular formula C19H10N2O3 and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-[4-(5-formylfuran-2-yl)phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-(5-formylfuran-2-yl)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 169331994 |
| Molecular Formula | C19H10N2O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 4-[4-(5-formylfuran-2-yl)phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(-c3ccc(C=O)o3)cc2)cc1C#N |
| InChI | InChI=1S/C19H10N2O3/c20-10-14-3-6-17(9-15(14)11-21)23-16-4-1-13(2-5-16)19-8-7-18(12-22)24-19/h1-9,12H |
| InChIKey | RLWQUMJQVKMVLP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|