C9H13NO3S — CID 21127023
5-hydroxy-N,N,2-trimethylbenzenesulfonamide (PubChem CID 21127023) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 5-hydroxy-N,N,2-trimethylbenzenesulfonamide.
| Compound Name | 5-hydroxy-N,N,2-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 21127023 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 5-hydroxy-N,N,2-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(O)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H13NO3S/c1-7-4-5-8(11)6-9(7)14(12,13)10(2)3/h4-6,11H,1-3H3 |
| InChIKey | GVMDRNZTRHNWRB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |