C16H14O4 — CID 169333699
5-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)furan-2-carbaldehyde (PubChem CID 169333699) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 5-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)furan-2-carbaldehyde.
| Compound Name | 5-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333699 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 5-(2,2-dimethyl-4-oxo-3H-chromen-6-yl)furan-2-carbaldehyde |
| SMILES | CC1(C)CC(=O)c2cc(-c3ccc(C=O)o3)ccc2O1 |
| InChI | InChI=1S/C16H14O4/c1-16(2)8-13(18)12-7-10(3-5-15(12)20-16)14-6-4-11(9-17)19-14/h3-7,9H,8H2,1-2H3 |
| InChIKey | KWVJJEQAGFTEBL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|