About ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate
ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 169334928) has the molecular formula C21H21NO6
and a molecular weight of 383.40 g/mol. Its IUPAC name is ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| PubChem CID | 169334928 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)CC(=O)c1cc(-c3ccc(C=O)o3)ccc1O2 |
| InChI | InChI=1S/C21H21NO6/c1-2-26-20(25)22-9-7-21(8-10-22)12-17(24)16-11-14(3-5-19(16)28-21)18-6-4-15(13-23)27-18/h3-6,11,13H,2,7-10,12H2,1H3 |
| InChIKey | DDJGDMPXYVULBH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The IUPAC name of ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (CID 169334928) is ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
What is the SMILES notation for ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The canonical SMILES for ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate is CCOC(=O)N1CCC2(CC1)CC(=O)c1cc(-c3ccc(C=O)o3)ccc1O2.
What is the InChIKey of ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
The InChIKey is DDJGDMPXYVULBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO6/c1-2-26-20(25)22-9-7-21(8-10-22)12-17(24)16-11-14(3-5-19(16)28-21)18-6-4-15(13-23)27-18/h3-6,11,13H,2,7-10,12H2,1H3.
What are the key properties of ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate?
ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate has a molecular weight of 383.40 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate is sourced from PubChem (CID 169334928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).