C21H21NO6 — CID 169334928
ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 169334928) has the molecular formula C21H21NO6 and a molecular weight of 383.40 g/mol. Its IUPAC name is ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 169334928 |
| Molecular Formula | C21H21NO6 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | ethyl 6-(5-formylfuran-2-yl)-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CCOC(=O)N1CCC2(CC1)CC(=O)c1cc(-c3ccc(C=O)o3)ccc1O2 |
| InChI | InChI=1S/C21H21NO6/c1-2-26-20(25)22-9-7-21(8-10-22)12-17(24)16-11-14(3-5-19(16)28-21)18-6-4-15(13-23)27-18/h3-6,11,13H,2,7-10,12H2,1H3 |
| InChIKey | DDJGDMPXYVULBH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|