C25H32N2O7 — CID 87258285
ethyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-chromene-2,4'-azepane]-1'-carboxylate (PubChem CID 87258285) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is ethyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-chromene-2,4'-azepane]-1'-carboxylate.
| Compound Name | ethyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-chromene-2,4'-azepane]-1'-carboxylate |
|---|---|
| PubChem CID | 87258285 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | ethyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-chromene-2,4'-azepane]-1'-carboxylate |
| SMILES | CCOC(=O)N1CCCC2(CC1)CC(=O)c1cc(/C=C/C(=O)NOC3CCCCO3)ccc1O2 |
| InChI | InChI=1S/C25H32N2O7/c1-2-31-24(30)27-13-5-11-25(12-14-27)17-20(28)19-16-18(7-9-21(19)33-25)8-10-22(29)26-34-23-6-3-4-15-32-23/h7-10,16,23H,2-6,11-15,17H2,1H3,(H,26,29)/b10-8+ |
| InChIKey | IRAIYVGLGJBRAC-CSKARUKUSA-N |
| XLogP | 3.62 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|