C30H36N2O5 — CID 123769493
N-(oxan-2-yloxy)-3-[4-oxo-1'-(3-phenylpropyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enamide (PubChem CID 123769493) has the molecular formula C30H36N2O5 and a molecular weight of 504.63 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-3-[4-oxo-1'-(3-phenylpropyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enamide.
| Compound Name | N-(oxan-2-yloxy)-3-[4-oxo-1'-(3-phenylpropyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 123769493 |
| Molecular Formula | C30H36N2O5 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | N-(oxan-2-yloxy)-3-[4-oxo-1'-(3-phenylpropyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)C(=O)CC1(CCN(CCCc3ccccc3)CC1)O2)NOC1CCCCO1 |
| InChI | InChI=1S/C30H36N2O5/c33-26-22-30(15-18-32(19-16-30)17-6-9-23-7-2-1-3-8-23)36-27-13-11-24(21-25(26)27)12-14-28(34)31-37-29-10-4-5-20-35-29/h1-3,7-8,11-14,21,29H,4-6,9-10,15-20,22H2,(H,31,34) |
| InChIKey | FQZOAMXPALDVSB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|