C24H32N2O5 — CID 123526344
N-(oxan-2-yloxy)-3-(4-oxo-1'-propan-2-ylspiro[3H-chromene-2,4'-piperidine]-6-yl)prop-2-enamide (PubChem CID 123526344) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-3-(4-oxo-1'-propan-2-ylspiro[3H-chromene-2,4'-piperidine]-6-yl)prop-2-enamide.
| Compound Name | N-(oxan-2-yloxy)-3-(4-oxo-1'-propan-2-ylspiro[3H-chromene-2,4'-piperidine]-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 123526344 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-(oxan-2-yloxy)-3-(4-oxo-1'-propan-2-ylspiro[3H-chromene-2,4'-piperidine]-6-yl)prop-2-enamide |
| SMILES | CC(C)N1CCC2(CC1)CC(=O)c1cc(C=CC(=O)NOC3CCCCO3)ccc1O2 |
| InChI | InChI=1S/C24H32N2O5/c1-17(2)26-12-10-24(11-13-26)16-20(27)19-15-18(6-8-21(19)30-24)7-9-22(28)25-31-23-5-3-4-14-29-23/h6-9,15,17,23H,3-5,10-14,16H2,1-2H3,(H,25,28) |
| InChIKey | XZPYRMOVVTXQGK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|