C26H34N2O7 — CID 87258264
tert-butyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-chromene-2,3'-piperidine]-1'-carboxylate (PubChem CID 87258264) has the molecular formula C26H34N2O7 and a molecular weight of 486.57 g/mol. Its IUPAC name is tert-butyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-chromene-2,3'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-chromene-2,3'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 87258264 |
| Molecular Formula | C26H34N2O7 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | tert-butyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-chromene-2,3'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(CC(=O)c3cc(/C=C/C(=O)NOC4CCCCO4)ccc3O2)C1 |
| InChI | InChI=1S/C26H34N2O7/c1-25(2,3)34-24(31)28-13-6-12-26(17-28)16-20(29)19-15-18(8-10-21(19)33-26)9-11-22(30)27-35-23-7-4-5-14-32-23/h8-11,15,23H,4-7,12-14,16-17H2,1-3H3,(H,27,30)/b11-9+ |
| InChIKey | BPEBHCBUPOEAHR-PKNBQFBNSA-N |
| XLogP | 4.01 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|