C25H33N3O7 — CID 87208971
tert-butyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-1,3-benzoxazine-2,4'-piperidine]-1'-carboxylate (PubChem CID 87208971) has the molecular formula C25H33N3O7 and a molecular weight of 487.55 g/mol. Its IUPAC name is tert-butyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-1,3-benzoxazine-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-1,3-benzoxazine-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 87208971 |
| Molecular Formula | C25H33N3O7 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | tert-butyl 6-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-4-oxospiro[3H-1,3-benzoxazine-2,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)NC(=O)c1cc(/C=C/C(=O)NOC3CCCCO3)ccc1O2 |
| InChI | InChI=1S/C25H33N3O7/c1-24(2,3)34-23(31)28-13-11-25(12-14-28)26-22(30)18-16-17(7-9-19(18)33-25)8-10-20(29)27-35-21-6-4-5-15-32-21/h7-10,16,21H,4-6,11-15H2,1-3H3,(H,26,30)(H,27,29)/b10-8+ |
| InChIKey | VIJOCJSZIUQYML-CSKARUKUSA-N |
| XLogP | 3.12 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|