C21H29NO4S — CID 146175359
tert-butyl 4-oxo-6-(2-sulfanylpropan-2-yl)spiro[3H-chromene-2,4'-piperidine]-1'-carboxylate (PubChem CID 146175359) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is tert-butyl 4-oxo-6-(2-sulfanylpropan-2-yl)spiro[3H-chromene-2,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 4-oxo-6-(2-sulfanylpropan-2-yl)spiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 146175359 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | tert-butyl 4-oxo-6-(2-sulfanylpropan-2-yl)spiro[3H-chromene-2,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CC(=O)c1cc(C(C)(C)S)ccc1O2 |
| InChI | InChI=1S/C21H29NO4S/c1-19(2,3)26-18(24)22-10-8-21(9-11-22)13-16(23)15-12-14(20(4,5)27)6-7-17(15)25-21/h6-7,12,27H,8-11,13H2,1-5H3 |
| InChIKey | KWCNWFBLWZMMDD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|