C22H27NO6 — CID 77221189
3-[1'-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxospiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid (PubChem CID 77221189) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-[1'-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxospiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid.
| Compound Name | 3-[1'-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxospiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77221189 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-[1'-[(2-methylpropan-2-yl)oxycarbonyl]-4-oxospiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCC2(CC1)CC(=O)c1cc(C=CC(=O)O)ccc1O2 |
| InChI | InChI=1S/C22H27NO6/c1-21(2,3)29-20(27)23-11-4-9-22(10-12-23)14-17(24)16-13-15(6-8-19(25)26)5-7-18(16)28-22/h5-8,13H,4,9-12,14H2,1-3H3,(H,25,26) |
| InChIKey | WUZGTXWSZGAWIX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|