C24H24FNO4 — CID 77221171
3-[1'-[(4-fluorophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid (PubChem CID 77221171) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is 3-[1'-[(4-fluorophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid.
| Compound Name | 3-[1'-[(4-fluorophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77221171 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-[1'-[(4-fluorophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc2c(c1)C(=O)CC1(CCCN(Cc3ccc(F)cc3)CC1)O2 |
| InChI | InChI=1S/C24H24FNO4/c25-19-6-2-18(3-7-19)16-26-12-1-10-24(11-13-26)15-21(27)20-14-17(5-9-23(28)29)4-8-22(20)30-24/h2-9,14H,1,10-13,15-16H2,(H,28,29) |
| InChIKey | RDJKJYQMDMXHCQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|