C22H22N2O4 — CID 66932444
(E)-3-[4-oxo-1'-(pyridin-2-ylmethyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid (PubChem CID 66932444) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (E)-3-[4-oxo-1'-(pyridin-2-ylmethyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-oxo-1'-(pyridin-2-ylmethyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66932444 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (E)-3-[4-oxo-1'-(pyridin-2-ylmethyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc2c(c1)C(=O)CC1(CCN(Cc3ccccn3)CC1)O2 |
| InChI | InChI=1S/C22H22N2O4/c25-19-14-22(8-11-24(12-9-22)15-17-3-1-2-10-23-17)28-20-6-4-16(13-18(19)20)5-7-21(26)27/h1-7,10,13H,8-9,11-12,14-15H2,(H,26,27)/b7-5+ |
| InChIKey | WUOBYGONEDVNIX-FNORWQNLSA-N |
| XLogP | 3.18 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|