C26H26N2O4 — CID 66932461
(E)-3-[1'-[(1-methylindol-2-yl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid (PubChem CID 66932461) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is (E)-3-[1'-[(1-methylindol-2-yl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[1'-[(1-methylindol-2-yl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66932461 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (E)-3-[1'-[(1-methylindol-2-yl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid |
| SMILES | Cn1c(CN2CCC3(CC2)CC(=O)c2cc(/C=C/C(=O)O)ccc2O3)cc2ccccc21 |
| InChI | InChI=1S/C26H26N2O4/c1-27-20(15-19-4-2-3-5-22(19)27)17-28-12-10-26(11-13-28)16-23(29)21-14-18(7-9-25(30)31)6-8-24(21)32-26/h2-9,14-15H,10-13,16-17H2,1H3,(H,30,31)/b9-7+ |
| InChIKey | AXPAQBNIARJZRJ-VQHVLOKHSA-N |
| XLogP | 4.28 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|