C27H28N2O4 — CID 58147959
6-[(E)-4-hydroxy-3-oxobut-1-enyl]-1'-[(1-methylindol-2-yl)methyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 58147959) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 6-[(E)-4-hydroxy-3-oxobut-1-enyl]-1'-[(1-methylindol-2-yl)methyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-[(E)-4-hydroxy-3-oxobut-1-enyl]-1'-[(1-methylindol-2-yl)methyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 58147959 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 6-[(E)-4-hydroxy-3-oxobut-1-enyl]-1'-[(1-methylindol-2-yl)methyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cn1c(CN2CCC3(CC2)CC(=O)c2cc(/C=C/C(=O)CO)ccc2O3)cc2ccccc21 |
| InChI | InChI=1S/C27H28N2O4/c1-28-21(15-20-4-2-3-5-24(20)28)17-29-12-10-27(11-13-29)16-25(32)23-14-19(6-8-22(31)18-30)7-9-26(23)33-27/h2-9,14-15,30H,10-13,16-18H2,1H3/b8-6+ |
| InChIKey | UTRPEDCVGJLDGX-SOFGYWHQSA-N |
| XLogP | 3.75 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|