C25H27NO4 — CID 77221147
3-[4-oxo-1'-(2-phenylethyl)spiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid (PubChem CID 77221147) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 3-[4-oxo-1'-(2-phenylethyl)spiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid.
| Compound Name | 3-[4-oxo-1'-(2-phenylethyl)spiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77221147 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-[4-oxo-1'-(2-phenylethyl)spiro[3H-chromene-2,4'-azepane]-6-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc2c(c1)C(=O)CC1(CCCN(CCc3ccccc3)CC1)O2 |
| InChI | InChI=1S/C25H27NO4/c27-22-18-25(30-23-9-7-20(17-21(22)23)8-10-24(28)29)12-4-14-26(16-13-25)15-11-19-5-2-1-3-6-19/h1-3,5-10,17H,4,11-16,18H2,(H,28,29) |
| InChIKey | ODXLVTJROFRKJC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|