C29H27NO4 — CID 66932571
3-[4-oxo-1'-[(4-phenylphenyl)methyl]spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid (PubChem CID 66932571) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 3-[4-oxo-1'-[(4-phenylphenyl)methyl]spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid.
| Compound Name | 3-[4-oxo-1'-[(4-phenylphenyl)methyl]spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66932571 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 3-[4-oxo-1'-[(4-phenylphenyl)methyl]spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc2c(c1)C(=O)CC1(CCN(Cc3ccc(-c4ccccc4)cc3)CC1)O2 |
| InChI | InChI=1S/C29H27NO4/c31-26-19-29(34-27-12-8-21(18-25(26)27)9-13-28(32)33)14-16-30(17-15-29)20-22-6-10-24(11-7-22)23-4-2-1-3-5-23/h1-13,18H,14-17,19-20H2,(H,32,33) |
| InChIKey | XDKNCQVJOCRZBP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|