C24H25NO4 — CID 86712830
(E)-3-[4-oxo-1'-(1-phenylethyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid (PubChem CID 86712830) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (E)-3-[4-oxo-1'-(1-phenylethyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-oxo-1'-(1-phenylethyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 86712830 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (E)-3-[4-oxo-1'-(1-phenylethyl)spiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoic acid |
| SMILES | CC(c1ccccc1)N1CCC2(CC1)CC(=O)c1cc(/C=C/C(=O)O)ccc1O2 |
| InChI | InChI=1S/C24H25NO4/c1-17(19-5-3-2-4-6-19)25-13-11-24(12-14-25)16-21(26)20-15-18(8-10-23(27)28)7-9-22(20)29-24/h2-10,15,17H,11-14,16H2,1H3,(H,27,28)/b10-8+ |
| InChIKey | DMPCAGHBEDSJKP-CSKARUKUSA-N |
| XLogP | 4.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|