C27H28N2O4 — CID 66932507
methyl (E)-3-[1'-[1-(1H-indol-2-yl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoate (PubChem CID 66932507) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is methyl (E)-3-[1'-[1-(1H-indol-2-yl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1'-[1-(1H-indol-2-yl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66932507 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | methyl (E)-3-[1'-[1-(1H-indol-2-yl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)C(=O)CC1(CCN(C(C)c3cc4ccccc4[nH]3)CC1)O2 |
| InChI | InChI=1S/C27H28N2O4/c1-18(23-16-20-5-3-4-6-22(20)28-23)29-13-11-27(12-14-29)17-24(30)21-15-19(7-9-25(21)33-27)8-10-26(31)32-2/h3-10,15-16,18,28H,11-14,17H2,1-2H3/b10-8+ |
| InChIKey | DJOVUTZMKFWAPD-CSKARUKUSA-N |
| XLogP | 4.92 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|