C26H29NO5 — CID 66932513
methyl (E)-3-[1'-[2-(3-methoxyphenyl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoate (PubChem CID 66932513) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is methyl (E)-3-[1'-[2-(3-methoxyphenyl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1'-[2-(3-methoxyphenyl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 66932513 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | methyl (E)-3-[1'-[2-(3-methoxyphenyl)ethyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2c(c1)C(=O)CC1(CCN(CCc3cccc(OC)c3)CC1)O2 |
| InChI | InChI=1S/C26H29NO5/c1-30-21-5-3-4-19(16-21)10-13-27-14-11-26(12-15-27)18-23(28)22-17-20(6-8-24(22)32-26)7-9-25(29)31-2/h3-9,16-17H,10-15,18H2,1-2H3/b9-7+ |
| InChIKey | CEJGVRWBWYIZHJ-VQHVLOKHSA-N |
| XLogP | 3.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|