C24H23NO5 — CID 58147882
1'-benzoyl-6-[(E)-4-hydroxy-3-oxobut-1-enyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 58147882) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is 1'-benzoyl-6-[(E)-4-hydroxy-3-oxobut-1-enyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-benzoyl-6-[(E)-4-hydroxy-3-oxobut-1-enyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 58147882 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1'-benzoyl-6-[(E)-4-hydroxy-3-oxobut-1-enyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)C(=O)CC1(CCN(C(=O)c3ccccc3)CC1)O2)CO |
| InChI | InChI=1S/C24H23NO5/c26-16-19(27)8-6-17-7-9-22-20(14-17)21(28)15-24(30-22)10-12-25(13-11-24)23(29)18-4-2-1-3-5-18/h1-9,14,26H,10-13,15-16H2/b8-6+ |
| InChIKey | ZDKDWNJEKJVLKX-SOFGYWHQSA-N |
| XLogP | 2.90 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|