C23H23ClN2O4 — CID 123419493
3-[1'-[(2-chlorophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]-N-hydroxyprop-2-enamide (PubChem CID 123419493) has the molecular formula C23H23ClN2O4 and a molecular weight of 426.90 g/mol. Its IUPAC name is 3-[1'-[(2-chlorophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1'-[(2-chlorophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 123419493 |
| Molecular Formula | C23H23ClN2O4 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-[1'-[(2-chlorophenyl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)C(=O)CC1(CCN(Cc3ccccc3Cl)CC1)O2)NO |
| InChI | InChI=1S/C23H23ClN2O4/c24-19-4-2-1-3-17(19)15-26-11-9-23(10-12-26)14-20(27)18-13-16(5-7-21(18)30-23)6-8-22(28)25-29/h1-8,13,29H,9-12,14-15H2,(H,25,28) |
| InChIKey | VKNVSLWJBAATNA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|