C25H25ClFN3O4 — CID 173032830
3-[1'-[(5-fluoro-1H-indol-3-yl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]-N-hydroxyprop-2-enamide;hydrochloride (PubChem CID 173032830) has the molecular formula C25H25ClFN3O4 and a molecular weight of 485.94 g/mol. Its IUPAC name is 3-[1'-[(5-fluoro-1H-indol-3-yl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]-N-hydroxyprop-2-enamide;hydrochloride.
| Compound Name | 3-[1'-[(5-fluoro-1H-indol-3-yl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]-N-hydroxyprop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 173032830 |
| Molecular Formula | C25H25ClFN3O4 |
| Molecular Weight | 485.94 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 3-[1'-[(5-fluoro-1H-indol-3-yl)methyl]-4-oxospiro[3H-chromene-2,4'-piperidine]-6-yl]-N-hydroxyprop-2-enamide;hydrochloride |
| SMILES | Cl.O=C(C=Cc1ccc2c(c1)C(=O)CC1(CCN(Cc3c[nH]c4ccc(F)cc34)CC1)O2)NO |
| InChI | InChI=1S/C25H24FN3O4.ClH/c26-18-3-4-21-19(12-18)17(14-27-21)15-29-9-7-25(8-10-29)13-22(30)20-11-16(1-5-23(20)33-25)2-6-24(31)28-32;/h1-6,11-12,14,27,32H,7-10,13,15H2,(H,28,31);1H |
| InChIKey | GJVKNZPCZVRDFU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.94 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|