C15H24O2 — CID 90690524
2,2-dimethyl-3H-chromen-4-one;ethane (PubChem CID 90690524) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2,2-dimethyl-3H-chromen-4-one;ethane.
| Compound Name | 2,2-dimethyl-3H-chromen-4-one;ethane |
|---|---|
| PubChem CID | 90690524 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2,2-dimethyl-3H-chromen-4-one;ethane |
| SMILES | CC.CC.CC1(C)CC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C11H12O2.2C2H6/c1-11(2)7-9(12)8-5-3-4-6-10(8)13-11;2*1-2/h3-6H,7H2,1-2H3;2*1-2H3 |
| InChIKey | JDLKIJVTZHBQSL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |