C14H16O3 — CID 600886
5,5-dimethyl-2,6-dihydro-1H-4-benzoxonine-3,7-dione (PubChem CID 600886) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 5,5-dimethyl-2,6-dihydro-1H-4-benzoxonine-3,7-dione.
| Compound Name | 5,5-dimethyl-2,6-dihydro-1H-4-benzoxonine-3,7-dione |
|---|---|
| PubChem CID | 600886 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 5,5-dimethyl-2,6-dihydro-1H-4-benzoxonine-3,7-dione |
| SMILES | CC1(C)CC(=O)c2ccccc2CCC(=O)O1 |
| InChI | InChI=1S/C14H16O3/c1-14(2)9-12(15)11-6-4-3-5-10(11)7-8-13(16)17-14/h3-6H,7-9H2,1-2H3 |
| InChIKey | FSGMZRILZHZPPK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |