C12H13FO2 — CID 103920514
8-fluoro-2,2,7-trimethyl-3H-chromen-4-one (PubChem CID 103920514) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 8-fluoro-2,2,7-trimethyl-3H-chromen-4-one.
| Compound Name | 8-fluoro-2,2,7-trimethyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 103920514 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 8-fluoro-2,2,7-trimethyl-3H-chromen-4-one |
| SMILES | Cc1ccc2c(c1F)OC(C)(C)CC2=O |
| InChI | InChI=1S/C12H13FO2/c1-7-4-5-8-9(14)6-12(2,3)15-11(8)10(7)13/h4-5H,6H2,1-3H3 |
| InChIKey | QDQIZSFUPJAGPW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |