C11H11FO — CID 55297472
5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 55297472) has the molecular formula C11H11FO and a molecular weight of 178.21 g/mol. Its IUPAC name is 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 55297472 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | Cc1ccc2c(c1F)CCCC2=O |
| InChI | InChI=1S/C11H11FO/c1-7-5-6-8-9(11(7)12)3-2-4-10(8)13/h5-6H,2-4H2,1H3 |
| InChIKey | GDMUANYCDKJQDX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |