About 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one
5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 55297472) has the molecular formula C11H11FO
and a molecular weight of 178.21 g/mol. Its IUPAC name is 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 55297472 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | Cc1ccc2c(c1F)CCCC2=O |
| InChI | InChI=1S/C11H11FO/c1-7-5-6-8-9(11(7)12)3-2-4-10(8)13/h5-6H,2-4H2,1H3 |
| InChIKey | GDMUANYCDKJQDX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one (CID 55297472) is 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one is Cc1ccc2c(c1F)CCCC2=O.
What is the InChIKey of 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is GDMUANYCDKJQDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO/c1-7-5-6-8-9(11(7)12)3-2-4-10(8)13/h5-6H,2-4H2,1H3.
What are the key properties of 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one?
5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 178.21 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methyl-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 55297472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).