C10H7BrF2O — CID 171787843
5-bromo-6,7-difluoro-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 171787843) has the molecular formula C10H7BrF2O and a molecular weight of 261.06 g/mol. Its IUPAC name is 5-bromo-6,7-difluoro-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 5-bromo-6,7-difluoro-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 171787843 |
| Molecular Formula | C10H7BrF2O |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 5-bromo-6,7-difluoro-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2c1cc(F)c(F)c2Br |
| InChI | InChI=1S/C10H7BrF2O/c11-9-5-2-1-3-8(14)6(5)4-7(12)10(9)13/h4H,1-3H2 |
| InChIKey | INQRCPGASVABNG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|