C9H6BrFOS — CID 143203211
4-bromo-6-fluoro-5-sulfanyl-2,3-dihydroinden-1-one (PubChem CID 143203211) has the molecular formula C9H6BrFOS and a molecular weight of 261.11 g/mol. Its IUPAC name is 4-bromo-6-fluoro-5-sulfanyl-2,3-dihydroinden-1-one.
| Compound Name | 4-bromo-6-fluoro-5-sulfanyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 143203211 |
| Molecular Formula | C9H6BrFOS |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | 4-bromo-6-fluoro-5-sulfanyl-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2c1cc(F)c(S)c2Br |
| InChI | InChI=1S/C9H6BrFOS/c10-8-4-1-2-7(12)5(4)3-6(11)9(8)13/h3,13H,1-2H2 |
| InChIKey | WHPQQPKUOFAUIY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|