C11H6F6O — CID 121235774
4,6-bis(trifluoromethyl)-2,3-dihydroinden-1-one (PubChem CID 121235774) has the molecular formula C11H6F6O and a molecular weight of 268.16 g/mol. Its IUPAC name is 4,6-bis(trifluoromethyl)-2,3-dihydroinden-1-one.
| Compound Name | 4,6-bis(trifluoromethyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 121235774 |
| Molecular Formula | C11H6F6O |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 4,6-bis(trifluoromethyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2c1cc(C(F)(F)F)cc2C(F)(F)F |
| InChI | InChI=1S/C11H6F6O/c12-10(13,14)5-3-7-6(1-2-9(7)18)8(4-5)11(15,16)17/h3-4H,1-2H2 |
| InChIKey | HSBGMMDCWCHQIQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |