C10H5F6NO — CID 53404079
4,6-bis(trifluoromethyl)-1,3-dihydroindol-2-one (PubChem CID 53404079) has the molecular formula C10H5F6NO and a molecular weight of 269.14 g/mol. Its IUPAC name is 4,6-bis(trifluoromethyl)-1,3-dihydroindol-2-one.
| Compound Name | 4,6-bis(trifluoromethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 53404079 |
| Molecular Formula | C10H5F6NO |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 4,6-bis(trifluoromethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2c(cc(C(F)(F)F)cc2C(F)(F)F)N1 |
| InChI | InChI=1S/C10H5F6NO/c11-9(12,13)4-1-6(10(14,15)16)5-3-8(18)17-7(5)2-4/h1-2H,3H2,(H,17,18) |
| InChIKey | HLVRZEWWTDSSDH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |