C9H2F10 — CID 12503713
2-fluoro-1,3,5-tris(trifluoromethyl)benzene (PubChem CID 12503713) has the molecular formula C9H2F10 and a molecular weight of 300.10 g/mol. Its IUPAC name is 2-fluoro-1,3,5-tris(trifluoromethyl)benzene.
| Compound Name | 2-fluoro-1,3,5-tris(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 12503713 |
| Molecular Formula | C9H2F10 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-fluoro-1,3,5-tris(trifluoromethyl)benzene |
| SMILES | Fc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H2F10/c10-6-4(8(14,15)16)1-3(7(11,12)13)2-5(6)9(17,18)19/h1-2H |
| InChIKey | APVYUEZOPMPDLL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |