C72H16B2F72Mg — CID 87709525
magnesium bis(tetrakis[2,4,6-tris(trifluoromethyl)phenyl]boranuide) (PubChem CID 87709525) has the molecular formula C72H16B2F72Mg and a molecular weight of 2294.70 g/mol. Its IUPAC name is magnesium bis(tetrakis[2,4,6-tris(trifluoromethyl)phenyl]boranuide).
| Compound Name | magnesium bis(tetrakis[2,4,6-tris(trifluoromethyl)phenyl]boranuide) |
|---|---|
| PubChem CID | 87709525 |
| Molecular Formula | C72H16B2F72Mg |
| Molecular Weight | 2294.70 g/mol |
| Exact Mass | 2294.01 |
| IUPAC Name | magnesium bis(tetrakis[2,4,6-tris(trifluoromethyl)phenyl]boranuide) |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c([B-](c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)(c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)c(C(F)(F)F)c1.FC(F)(F)c1cc(C(F)(F)F)c([B-](c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)(c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)c2c(C(F)(F)F)cc(C(F)(F)F)cc2C(F)(F)F)c(C(F)(F)F)c1.[Mg+2] |
| InChI | InChI=1S/2C36H8BF36.Mg/c2*38-25(39,40)9-1-13(29(50,51)52)21(14(2-9)30(53,54)55)37(22-15(31(56,57)58)3-10(26(41,42)43)4-16(22)32(59,60)61,23-17(33(62,63)64)5-11(27(44,45)46)6-18(23)34(65,66)67)24-19(35(68,69)70)7-12(28(47,48)49)8-20(24)36(71,72)73;/h2*1-8H;/q2*-1;+2 |
| InChIKey | YTBBMOUEYKPRLK-UHFFFAOYSA-N |
| XLogP | 30.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 147 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 2294.70 |
| LogP ≤ 5 | 30.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|