C9H4F9NS — CID 129295053
S-[2,4,6-tris(trifluoromethyl)phenyl]thiohydroxylamine (PubChem CID 129295053) has the molecular formula C9H4F9NS and a molecular weight of 329.19 g/mol. Its IUPAC name is S-[2,4,6-tris(trifluoromethyl)phenyl]thiohydroxylamine.
| Compound Name | S-[2,4,6-tris(trifluoromethyl)phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 129295053 |
| Molecular Formula | C9H4F9NS |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | S-[2,4,6-tris(trifluoromethyl)phenyl]thiohydroxylamine |
| SMILES | NSc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H4F9NS/c10-7(11,12)3-1-4(8(13,14)15)6(20-19)5(2-3)9(16,17)18/h1-2H,19H2 |
| InChIKey | XBMMCVMHKUAFOL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|