C10H9F6NO2 — CID 66515808
2-[(1R)-1-amino-2-hydroxyethyl]-3,5-bis(trifluoromethyl)phenol (PubChem CID 66515808) has the molecular formula C10H9F6NO2 and a molecular weight of 289.18 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2-hydroxyethyl]-3,5-bis(trifluoromethyl)phenol.
| Compound Name | 2-[(1R)-1-amino-2-hydroxyethyl]-3,5-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 66515808 |
| Molecular Formula | C10H9F6NO2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-[(1R)-1-amino-2-hydroxyethyl]-3,5-bis(trifluoromethyl)phenol |
| SMILES | N[C@@H](CO)c1c(O)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H9F6NO2/c11-9(12,13)4-1-5(10(14,15)16)8(6(17)3-18)7(19)2-4/h1-2,6,18-19H,3,17H2/t6-/m0/s1 |
| InChIKey | ZDIFZBNTPIUNRD-LURJTMIESA-N |
| XLogP | 2.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|