C8H4F6OS — CID 119023054
2-sulfanyl-3,5-bis(trifluoromethyl)phenol (PubChem CID 119023054) has the molecular formula C8H4F6OS and a molecular weight of 262.17 g/mol. Its IUPAC name is 2-sulfanyl-3,5-bis(trifluoromethyl)phenol.
| Compound Name | 2-sulfanyl-3,5-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 119023054 |
| Molecular Formula | C8H4F6OS |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 2-sulfanyl-3,5-bis(trifluoromethyl)phenol |
| SMILES | Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1S |
| InChI | InChI=1S/C8H4F6OS/c9-7(10,11)3-1-4(8(12,13)14)6(16)5(15)2-3/h1-2,15-16H |
| InChIKey | DZIULVJGHFLIRN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|