C10H3BF12O — CID 142651418
2-[bis(trifluoromethyl)boranyl]-4,6-bis(trifluoromethyl)phenol (PubChem CID 142651418) has the molecular formula C10H3BF12O and a molecular weight of 377.92 g/mol. Its IUPAC name is 2-[bis(trifluoromethyl)boranyl]-4,6-bis(trifluoromethyl)phenol.
| Compound Name | 2-[bis(trifluoromethyl)boranyl]-4,6-bis(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 142651418 |
| Molecular Formula | C10H3BF12O |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 2-[bis(trifluoromethyl)boranyl]-4,6-bis(trifluoromethyl)phenol |
| SMILES | Oc1c(B(C(F)(F)F)C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H3BF12O/c12-7(13,14)3-1-4(8(15,16)17)6(24)5(2-3)11(9(18,19)20)10(21,22)23/h1-2,24H |
| InChIKey | HIEQPEXLIOPSHD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|