C8H8BF6NO2 — CID 162335325
azane;[2,4-bis(trifluoromethyl)phenyl]boronic acid (PubChem CID 162335325) has the molecular formula C8H8BF6NO2 and a molecular weight of 274.96 g/mol. Its IUPAC name is azane;[2,4-bis(trifluoromethyl)phenyl]boronic acid.
| Compound Name | azane;[2,4-bis(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 162335325 |
| Molecular Formula | C8H8BF6NO2 |
| Molecular Weight | 274.96 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | azane;[2,4-bis(trifluoromethyl)phenyl]boronic acid |
| SMILES | N.OB(O)c1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C8H5BF6O2.H3N/c10-7(11,12)4-1-2-6(9(16)17)5(3-4)8(13,14)15;/h1-3,16-17H;1H3 |
| InChIKey | XNLMBYRXFZGECH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.96 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|