C13H17BF3NO2 — CID 58734126
[2-(piperidin-1-ylmethyl)-4-(trifluoromethyl)phenyl]boronic acid (PubChem CID 58734126) has the molecular formula C13H17BF3NO2 and a molecular weight of 287.09 g/mol. Its IUPAC name is [2-(piperidin-1-ylmethyl)-4-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | [2-(piperidin-1-ylmethyl)-4-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 58734126 |
| Molecular Formula | C13H17BF3NO2 |
| Molecular Weight | 287.09 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | [2-(piperidin-1-ylmethyl)-4-(trifluoromethyl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(C(F)(F)F)cc1CN1CCCCC1 |
| InChI | InChI=1S/C13H17BF3NO2/c15-13(16,17)11-4-5-12(14(19)20)10(8-11)9-18-6-2-1-3-7-18/h4-5,8,19-20H,1-3,6-7,9H2 |
| InChIKey | DEJQTCPRTFDADN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.09 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|