C14H20BNO2 — CID 174793184
[4-ethenyl-2-(piperidin-1-ylmethyl)phenyl]boronic acid (PubChem CID 174793184) has the molecular formula C14H20BNO2 and a molecular weight of 245.13 g/mol. Its IUPAC name is [4-ethenyl-2-(piperidin-1-ylmethyl)phenyl]boronic acid.
| Compound Name | [4-ethenyl-2-(piperidin-1-ylmethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 174793184 |
| Molecular Formula | C14H20BNO2 |
| Molecular Weight | 245.13 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | [4-ethenyl-2-(piperidin-1-ylmethyl)phenyl]boronic acid |
| SMILES | C=Cc1ccc(B(O)O)c(CN2CCCCC2)c1 |
| InChI | InChI=1S/C14H20BNO2/c1-2-12-6-7-14(15(17)18)13(10-12)11-16-8-4-3-5-9-16/h2,6-7,10,17-18H,1,3-5,8-9,11H2 |
| InChIKey | RZKHVDWBGSWJKK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.13 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|