C15H24BNO3 — CID 65327480
[2-[(3-ethylpiperidin-1-yl)methyl]-4-methoxyphenyl]boronic acid (PubChem CID 65327480) has the molecular formula C15H24BNO3 and a molecular weight of 277.17 g/mol. Its IUPAC name is [2-[(3-ethylpiperidin-1-yl)methyl]-4-methoxyphenyl]boronic acid.
| Compound Name | [2-[(3-ethylpiperidin-1-yl)methyl]-4-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 65327480 |
| Molecular Formula | C15H24BNO3 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | [2-[(3-ethylpiperidin-1-yl)methyl]-4-methoxyphenyl]boronic acid |
| SMILES | CCC1CCCN(Cc2cc(OC)ccc2B(O)O)C1 |
| InChI | InChI=1S/C15H24BNO3/c1-3-12-5-4-8-17(10-12)11-13-9-14(20-2)6-7-15(13)16(18)19/h6-7,9,12,18-19H,3-5,8,10-11H2,1-2H3 |
| InChIKey | KLAMFKPVAJLOSC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|