C22H27ClF3NO — CID 122184324
2-(piperidin-1-ylmethyl)-4-[3-[4-(trifluoromethyl)phenyl]propyl]phenol;hydrochloride (PubChem CID 122184324) has the molecular formula C22H27ClF3NO and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-(piperidin-1-ylmethyl)-4-[3-[4-(trifluoromethyl)phenyl]propyl]phenol;hydrochloride.
| Compound Name | 2-(piperidin-1-ylmethyl)-4-[3-[4-(trifluoromethyl)phenyl]propyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 122184324 |
| Molecular Formula | C22H27ClF3NO |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-(piperidin-1-ylmethyl)-4-[3-[4-(trifluoromethyl)phenyl]propyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(CCCc2ccc(C(F)(F)F)cc2)cc1CN1CCCCC1 |
| InChI | InChI=1S/C22H26F3NO.ClH/c23-22(24,25)20-10-7-17(8-11-20)5-4-6-18-9-12-21(27)19(15-18)16-26-13-2-1-3-14-26;/h7-12,15,27H,1-6,13-14,16H2;1H |
| InChIKey | MVAYPECUMXFBIF-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|