C9H2F9N3 — CID 154016237
2-azido-1,3,5-tris(trifluoromethyl)benzene (PubChem CID 154016237) has the molecular formula C9H2F9N3 and a molecular weight of 323.12 g/mol. Its IUPAC name is 2-azido-1,3,5-tris(trifluoromethyl)benzene.
| Compound Name | 2-azido-1,3,5-tris(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 154016237 |
| Molecular Formula | C9H2F9N3 |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-azido-1,3,5-tris(trifluoromethyl)benzene |
| SMILES | [N-]=[N+]=Nc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H2F9N3/c10-7(11,12)3-1-4(8(13,14)15)6(20-21-19)5(2-3)9(16,17)18/h1-2H |
| InChIKey | IBIBAQKUNUNGDK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|