About 2-azido-1,3,5-tris(trifluoromethyl)benzene
2-azido-1,3,5-tris(trifluoromethyl)benzene (PubChem CID 154016237) has the molecular formula C9H2F9N3
and a molecular weight of 323.12 g/mol. Its IUPAC name is 2-azido-1,3,5-tris(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 2-azido-1,3,5-tris(trifluoromethyl)benzene |
| PubChem CID | 154016237 |
| Molecular Formula | C9H2F9N3 |
| Molecular Weight | 323.12 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-azido-1,3,5-tris(trifluoromethyl)benzene |
| SMILES | [N-]=[N+]=Nc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C9H2F9N3/c10-7(11,12)3-1-4(8(13,14)15)6(20-21-19)5(2-3)9(16,17)18/h1-2H |
| InChIKey | IBIBAQKUNUNGDK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.12 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-1,3,5-tris(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-1,3,5-tris(trifluoromethyl)benzene?
The IUPAC name of 2-azido-1,3,5-tris(trifluoromethyl)benzene (CID 154016237) is 2-azido-1,3,5-tris(trifluoromethyl)benzene.
What is the SMILES notation for 2-azido-1,3,5-tris(trifluoromethyl)benzene?
The canonical SMILES for 2-azido-1,3,5-tris(trifluoromethyl)benzene is [N-]=[N+]=Nc1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F.
What is the InChIKey of 2-azido-1,3,5-tris(trifluoromethyl)benzene?
The InChIKey is IBIBAQKUNUNGDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H2F9N3/c10-7(11,12)3-1-4(8(13,14)15)6(20-21-19)5(2-3)9(16,17)18/h1-2H.
What are the key properties of 2-azido-1,3,5-tris(trifluoromethyl)benzene?
2-azido-1,3,5-tris(trifluoromethyl)benzene has a molecular weight of 323.12 g/mol, XLogP of 5.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1,3,5-tris(trifluoromethyl)benzene is sourced from PubChem (CID 154016237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).