C8H4F6N4 — CID 23461157
2-azido-4,6-bis(trifluoromethyl)aniline (PubChem CID 23461157) has the molecular formula C8H4F6N4 and a molecular weight of 270.14 g/mol. Its IUPAC name is 2-azido-4,6-bis(trifluoromethyl)aniline.
| Compound Name | 2-azido-4,6-bis(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 23461157 |
| Molecular Formula | C8H4F6N4 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | 2-azido-4,6-bis(trifluoromethyl)aniline |
| SMILES | [N-]=[N+]=Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1N |
| InChI | InChI=1S/C8H4F6N4/c9-7(10,11)3-1-4(8(12,13)14)6(15)5(2-3)17-18-16/h1-2H,15H2 |
| InChIKey | FEWAUEGSAQZPTD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|