C14H7F6N3O — CID 169326536
1-azido-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-fluoro-4-methylbenzene (PubChem CID 169326536) has the molecular formula C14H7F6N3O and a molecular weight of 347.22 g/mol. Its IUPAC name is 1-azido-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-fluoro-4-methylbenzene.
| Compound Name | 1-azido-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 169326536 |
| Molecular Formula | C14H7F6N3O |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 1-azido-2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-fluoro-4-methylbenzene |
| SMILES | Cc1cc(Oc2c(F)cc(C(F)(F)F)cc2F)c(N=[N+]=[N-])cc1F |
| InChI | InChI=1S/C14H7F6N3O/c1-6-2-12(11(22-23-21)5-8(6)15)24-13-9(16)3-7(4-10(13)17)14(18,19)20/h2-5H,1H3 |
| InChIKey | XOWMJALNSKFUCP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|