C14H7F5INO2 — CID 168652057
N-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-iodophenyl]formamide (PubChem CID 168652057) has the molecular formula C14H7F5INO2 and a molecular weight of 443.11 g/mol. Its IUPAC name is N-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-iodophenyl]formamide.
| Compound Name | N-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-iodophenyl]formamide |
|---|---|
| PubChem CID | 168652057 |
| Molecular Formula | C14H7F5INO2 |
| Molecular Weight | 443.11 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | N-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-iodophenyl]formamide |
| SMILES | O=CNc1ccc(I)cc1Oc1c(F)cc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H7F5INO2/c15-9-3-7(14(17,18)19)4-10(16)13(9)23-12-5-8(20)1-2-11(12)21-6-22/h1-6H,(H,21,22) |
| InChIKey | MJMIQDXJKCDMGL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.11 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|