C18H8F5IO3 — CID 169335837
5-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-iodophenyl]furan-2-carbaldehyde (PubChem CID 169335837) has the molecular formula C18H8F5IO3 and a molecular weight of 494.15 g/mol. Its IUPAC name is 5-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-iodophenyl]furan-2-carbaldehyde.
| Compound Name | 5-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-iodophenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335837 |
| Molecular Formula | C18H8F5IO3 |
| Molecular Weight | 494.15 g/mol |
| Exact Mass | 493.94 |
| IUPAC Name | 5-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-5-iodophenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(I)ccc2Oc2c(F)cc(C(F)(F)F)cc2F)o1 |
| InChI | InChI=1S/C18H8F5IO3/c19-13-5-9(18(21,22)23)6-14(20)17(13)27-16-3-1-10(24)7-12(16)15-4-2-11(8-25)26-15/h1-8H |
| InChIKey | UUVYTPDBTWUYCZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.15 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|