C14H7F7O3 — CID 169334255
5-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169334255) has the molecular formula C14H7F7O3 and a molecular weight of 356.19 g/mol. Its IUPAC name is 5-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334255 |
| Molecular Formula | C14H7F7O3 |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 5-[2-fluoro-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2F)o1 |
| InChI | InChI=1S/C14H7F7O3/c15-10-5-7(12(23,13(16,17)18)14(19,20)21)1-3-9(10)11-4-2-8(6-22)24-11/h1-6,23H |
| InChIKey | LACPCCRYFILYOQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|