C14H9F5O3 — CID 169334678
5-[2-(2,2-difluoroethoxy)-5-(trifluoromethyl)phenyl]furan-2-carbaldehyde (PubChem CID 169334678) has the molecular formula C14H9F5O3 and a molecular weight of 320.21 g/mol. Its IUPAC name is 5-[2-(2,2-difluoroethoxy)-5-(trifluoromethyl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[2-(2,2-difluoroethoxy)-5-(trifluoromethyl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334678 |
| Molecular Formula | C14H9F5O3 |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 5-[2-(2,2-difluoroethoxy)-5-(trifluoromethyl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(C(F)(F)F)ccc2OCC(F)F)o1 |
| InChI | InChI=1S/C14H9F5O3/c15-13(16)7-21-11-3-1-8(14(17,18)19)5-10(11)12-4-2-9(6-20)22-12/h1-6,13H,7H2 |
| InChIKey | YMGWHXNDHKAXAG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|