C17H7F6N3O — CID 168545200
2-[[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-fluoroanilino]methylidene]propanedinitrile (PubChem CID 168545200) has the molecular formula C17H7F6N3O and a molecular weight of 383.25 g/mol. Its IUPAC name is 2-[[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-fluoroanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-fluoroanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168545200 |
| Molecular Formula | C17H7F6N3O |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-[[3-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4-fluoroanilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(F)c(Oc2c(F)cc(C(F)(F)F)cc2F)c1 |
| InChI | InChI=1S/C17H7F6N3O/c18-12-2-1-11(26-8-9(6-24)7-25)5-15(12)27-16-13(19)3-10(4-14(16)20)17(21,22)23/h1-5,8,26H |
| InChIKey | ONOJTHRVGWKFRX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|